C24H36N2O2 — CID 60602172
1-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]-5-(4-methylphenyl)pentan-1-one (PubChem CID 60602172) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]-5-(4-methylphenyl)pentan-1-one.
| Compound Name | 1-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]-5-(4-methylphenyl)pentan-1-one |
|---|---|
| PubChem CID | 60602172 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]-5-(4-methylphenyl)pentan-1-one |
| SMILES | Cc1ccc(CCCCC(=O)N2CCN(C(=O)CCC3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H36N2O2/c1-20-10-12-22(13-11-20)8-4-5-9-23(27)25-16-18-26(19-17-25)24(28)15-14-21-6-2-3-7-21/h10-13,21H,2-9,14-19H2,1H3 |
| InChIKey | VFPOLZJLMPODEF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|