C18H27N3O2 — CID 56826505
4-[5-(4-methylphenyl)pentanoyl]-1,4-diazepane-1-carboxamide (PubChem CID 56826505) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)pentanoyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[5-(4-methylphenyl)pentanoyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 56826505 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 4-[5-(4-methylphenyl)pentanoyl]-1,4-diazepane-1-carboxamide |
| SMILES | Cc1ccc(CCCCC(=O)N2CCCN(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C18H27N3O2/c1-15-7-9-16(10-8-15)5-2-3-6-17(22)20-11-4-12-21(14-13-20)18(19)23/h7-10H,2-6,11-14H2,1H3,(H2,19,23) |
| InChIKey | YSRRJGKUDAIYOQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|