C24H31N3O4 — CID 108555684
3-cyclohexyl-N-[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]propanamide (PubChem CID 108555684) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-cyclohexyl-N-[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108555684 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 3-cyclohexyl-N-[1-[2-(1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]propanamide |
| SMILES | O=C(CCC1CCCCC1)NC1CCN(C(=O)CN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C24H31N3O4/c28-21(11-10-17-6-2-1-3-7-17)25-18-12-14-26(15-13-18)22(29)16-27-23(30)19-8-4-5-9-20(19)24(27)31/h4-5,8-9,17-18H,1-3,6-7,10-16H2,(H,25,28) |
| InChIKey | DICKNDCRPCUBET-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|