C22H25ClN2O3 — CID 108566597
benzyl N-[1-[3-(4-chlorophenyl)propanoyl]piperidin-4-yl]carbamate (PubChem CID 108566597) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is benzyl N-[1-[3-(4-chlorophenyl)propanoyl]piperidin-4-yl]carbamate.
| Compound Name | benzyl N-[1-[3-(4-chlorophenyl)propanoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108566597 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | benzyl N-[1-[3-(4-chlorophenyl)propanoyl]piperidin-4-yl]carbamate |
| SMILES | O=C(NC1CCN(C(=O)CCc2ccc(Cl)cc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H25ClN2O3/c23-19-9-6-17(7-10-19)8-11-21(26)25-14-12-20(13-15-25)24-22(27)28-16-18-4-2-1-3-5-18/h1-7,9-10,20H,8,11-16H2,(H,24,27) |
| InChIKey | PFXPUKXQZSISLX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |