C23H26ClN3O3 — CID 46411290
N'-[2-(4-chlorophenyl)acetyl]-1-(3-phenylpropanoyl)piperidine-4-carbohydrazide (PubChem CID 46411290) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-1-(3-phenylpropanoyl)piperidine-4-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-1-(3-phenylpropanoyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 46411290 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-1-(3-phenylpropanoyl)piperidine-4-carbohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)C1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H26ClN3O3/c24-20-9-6-18(7-10-20)16-21(28)25-26-23(30)19-12-14-27(15-13-19)22(29)11-8-17-4-2-1-3-5-17/h1-7,9-10,19H,8,11-16H2,(H,25,28)(H,26,30) |
| InChIKey | VTHLGWHQVCXGDK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|