C16H20I2N2O4 — CID 4194818
[2-(cycloheptylamino)-2-oxoethyl] 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate (PubChem CID 4194818) has the molecular formula C16H20I2N2O4 and a molecular weight of 558.15 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 4194818 |
| Molecular Formula | C16H20I2N2O4 |
| Molecular Weight | 558.15 g/mol |
| Exact Mass | 557.95 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate |
| SMILES | O=C(COC(=O)Cn1cc(I)c(=O)c(I)c1)NC1CCCCCC1 |
| InChI | InChI=1S/C16H20I2N2O4/c17-12-7-20(8-13(18)16(12)23)9-15(22)24-10-14(21)19-11-5-3-1-2-4-6-11/h7-8,11H,1-6,9-10H2,(H,19,21) |
| InChIKey | YXHJJJQYYYRRLE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|