About [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate
[2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (PubChem CID 55998967) has the molecular formula C14H24N2O5S
and a molecular weight of 332.42 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
Molecular Properties
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate |
| PubChem CID | 55998967 |
| Molecular Formula | C14H24N2O5S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate |
| SMILES | O=C(COC(=O)CN1CCS(=O)(=O)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C14H24N2O5S/c17-13(15-12-4-2-1-3-5-12)11-21-14(18)10-16-6-8-22(19,20)9-7-16/h12H,1-11H2,(H,15,17) |
| InChIKey | ZCUNDXGYWDDDEV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The IUPAC name of [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (CID 55998967) is [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
What is the SMILES notation for [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The canonical SMILES for [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate is O=C(COC(=O)CN1CCS(=O)(=O)CC1)NC1CCCCC1.
What is the InChIKey of [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The InChIKey is ZCUNDXGYWDDDEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O5S/c17-13(15-12-4-2-1-3-5-12)11-21-14(18)10-16-6-8-22(19,20)9-7-16/h12H,1-11H2,(H,15,17).
What are the key properties of [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
[2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate has a molecular weight of 332.42 g/mol, XLogP of -0.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclohexylamino)-2-oxoethyl] 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate is sourced from PubChem (CID 55998967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).