C20H22Cl2N2O5 — CID 35776839
[2-(cyclooctylamino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 35776839) has the molecular formula C20H22Cl2N2O5 and a molecular weight of 441.31 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 35776839 |
| Molecular Formula | C20H22Cl2N2O5 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C20H22Cl2N2O5/c21-15-8-13-14(9-16(15)22)20(28)24(19(13)27)10-18(26)29-11-17(25)23-12-6-4-2-1-3-5-7-12/h8-9,12H,1-7,10-11H2,(H,23,25) |
| InChIKey | OWPTUYJYSMHMFR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|