C16H15Cl2N3O4 — CID 2708398
N-(cyclopentylcarbamoyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 2708398) has the molecular formula C16H15Cl2N3O4 and a molecular weight of 384.22 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 2708398 |
| Molecular Formula | C16H15Cl2N3O4 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H15Cl2N3O4/c17-11-5-9-10(6-12(11)18)15(24)21(14(9)23)7-13(22)20-16(25)19-8-3-1-2-4-8/h5-6,8H,1-4,7H2,(H2,19,20,22,25) |
| InChIKey | QZFASIGLQWPMSS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|