C18H11Cl3N2O5 — CID 35776828
[2-(3-chloroanilino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 35776828) has the molecular formula C18H11Cl3N2O5 and a molecular weight of 441.65 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 35776828 |
| Molecular Formula | C18H11Cl3N2O5 |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H11Cl3N2O5/c19-9-2-1-3-10(4-9)22-15(24)8-28-16(25)7-23-17(26)11-5-13(20)14(21)6-12(11)18(23)27/h1-6H,7-8H2,(H,22,24) |
| InChIKey | VBYDPWZOQPDEJD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|