C18H12ClFN2O5 — CID 2554656
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 2554656) has the molecular formula C18H12ClFN2O5 and a molecular weight of 390.75 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 2554656 |
| Molecular Formula | C18H12ClFN2O5 |
| Molecular Weight | 390.75 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)c2ccccc2C1=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H12ClFN2O5/c19-10-5-6-14(13(20)7-10)21-15(23)9-27-16(24)8-22-17(25)11-3-1-2-4-12(11)18(22)26/h1-7H,8-9H2,(H,21,23) |
| InChIKey | BCVOFYUMZIPBMT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|