C18H17ClFNO4 — CID 9139581
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-methylphenoxy)propanoate (PubChem CID 9139581) has the molecular formula C18H17ClFNO4 and a molecular weight of 365.79 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-methylphenoxy)propanoate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 9139581 |
| Molecular Formula | C18H17ClFNO4 |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-methylphenoxy)propanoate |
| SMILES | Cc1ccc(OCCC(=O)OCC(=O)Nc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C18H17ClFNO4/c1-12-2-5-14(6-3-12)24-9-8-18(23)25-11-17(22)21-16-7-4-13(19)10-15(16)20/h2-7,10H,8-9,11H2,1H3,(H,21,22) |
| InChIKey | IXMBWCQBOXKDGW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |