C17H12ClFN2O4 — CID 9141284
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-(4-cyanophenoxy)acetate (PubChem CID 9141284) has the molecular formula C17H12ClFN2O4 and a molecular weight of 362.74 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-(4-cyanophenoxy)acetate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 9141284 |
| Molecular Formula | C17H12ClFN2O4 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
| SMILES | N#Cc1ccc(OCC(=O)OCC(=O)Nc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C17H12ClFN2O4/c18-12-3-6-15(14(19)7-12)21-16(22)9-25-17(23)10-24-13-4-1-11(8-20)2-5-13/h1-7H,9-10H2,(H,21,22) |
| InChIKey | OKLQWGRBQDOZMT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |