C21H14Cl2N2O2 — CID 1034300
2-[4-(4-cyanophenyl)phenoxy]-N-(2,4-dichlorophenyl)acetamide (PubChem CID 1034300) has the molecular formula C21H14Cl2N2O2 and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)phenoxy]-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-[4-(4-cyanophenyl)phenoxy]-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 1034300 |
| Molecular Formula | C21H14Cl2N2O2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[4-(4-cyanophenyl)phenoxy]-N-(2,4-dichlorophenyl)acetamide |
| SMILES | N#Cc1ccc(-c2ccc(OCC(=O)Nc3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O2/c22-17-7-10-20(19(23)11-17)25-21(26)13-27-18-8-5-16(6-9-18)15-3-1-14(12-24)2-4-15/h1-11H,13H2,(H,25,26) |
| InChIKey | FYWSEXZQRZLZSV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |