C18H17ClFNO3S — CID 8854773
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfanylpropanoate (PubChem CID 8854773) has the molecular formula C18H17ClFNO3S and a molecular weight of 381.86 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfanylpropanoate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 8854773 |
| Molecular Formula | C18H17ClFNO3S |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(SCCC(=O)OCC(=O)Nc2cc(Cl)ccc2F)cc1 |
| InChI | InChI=1S/C18H17ClFNO3S/c1-12-2-5-14(6-3-12)25-9-8-18(23)24-11-17(22)21-16-10-13(19)4-7-15(16)20/h2-7,10H,8-9,11H2,1H3,(H,21,22) |
| InChIKey | JDSMXTUXWREFLL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |