C19H14ClFN2O4 — CID 16579571
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1-methylidene-3-oxoisoindol-2-yl)acetate (PubChem CID 16579571) has the molecular formula C19H14ClFN2O4 and a molecular weight of 388.78 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1-methylidene-3-oxoisoindol-2-yl)acetate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1-methylidene-3-oxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 16579571 |
| Molecular Formula | C19H14ClFN2O4 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1-methylidene-3-oxoisoindol-2-yl)acetate |
| SMILES | C=C1c2ccccc2C(=O)N1CC(=O)OCC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C19H14ClFN2O4/c1-11-13-4-2-3-5-14(13)19(26)23(11)9-18(25)27-10-17(24)22-16-8-12(20)6-7-15(16)21/h2-8H,1,9-10H2,(H,22,24) |
| InChIKey | UCJAORJLRNEEBS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |