C20H15BrClFN2O5 — CID 55375205
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 55375205) has the molecular formula C20H15BrClFN2O5 and a molecular weight of 497.70 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 55375205 |
| Molecular Formula | C20H15BrClFN2O5 |
| Molecular Weight | 497.70 g/mol |
| Exact Mass | 495.98 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | O=C(COC(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C20H15BrClFN2O5/c21-11-3-5-13-14(8-11)20(29)25(19(13)28)7-1-2-18(27)30-10-17(26)24-16-9-12(22)4-6-15(16)23/h3-6,8-9H,1-2,7,10H2,(H,24,26) |
| InChIKey | CPZRDIVEVRBVCA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|