C22H27BrN2O5 — CID 55375708
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 55375708) has the molecular formula C22H27BrN2O5 and a molecular weight of 479.37 g/mol. Its IUPAC name is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 55375708 |
| Molecular Formula | C22H27BrN2O5 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CC1CCCC(NC(=O)COC(=O)CCCN2C(=O)c3ccc(Br)cc3C2=O)C1C |
| InChI | InChI=1S/C22H27BrN2O5/c1-13-5-3-6-18(14(13)2)24-19(26)12-30-20(27)7-4-10-25-21(28)16-9-8-15(23)11-17(16)22(25)29/h8-9,11,13-14,18H,3-7,10,12H2,1-2H3,(H,24,26) |
| InChIKey | VQTXTQMWWOFLRI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|