C21H26N2O5 — CID 11925622
[2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate (PubChem CID 11925622) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is [2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate.
| Compound Name | [2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
|---|---|
| PubChem CID | 11925622 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(1,3-dioxo-4H-isoquinolin-2-yl)acetate |
| SMILES | C[C@H]1[C@@H](NC(=O)COC(=O)CN2C(=O)Cc3ccccc3C2=O)CCC[C@@H]1C |
| InChI | InChI=1S/C21H26N2O5/c1-13-6-5-9-17(14(13)2)22-18(24)12-28-20(26)11-23-19(25)10-15-7-3-4-8-16(15)21(23)27/h3-4,7-8,13-14,17H,5-6,9-12H2,1-2H3,(H,22,24)/t13-,14+,17-/m0/s1 |
| InChIKey | HHLRAYOEMNTKFZ-VBQJREDUSA-N |
| XLogP | 1.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|