C18H11F3N2O5 — CID 7804579
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 7804579) has the molecular formula C18H11F3N2O5 and a molecular weight of 392.29 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 7804579 |
| Molecular Formula | C18H11F3N2O5 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)C(=O)c2ccccc21)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H11F3N2O5/c19-10-5-6-11(16(21)15(10)20)22-13(24)8-28-14(25)7-23-12-4-2-1-3-9(12)17(26)18(23)27/h1-6H,7-8H2,(H,22,24) |
| InChIKey | NWPBIRZKILDXMB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|