C19H13F3N2O5 — CID 7804457
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 7804457) has the molecular formula C19H13F3N2O5 and a molecular weight of 406.32 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 7804457 |
| Molecular Formula | C19H13F3N2O5 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | C[C@H](OC(=O)CN1C(=O)C(=O)c2ccccc21)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H13F3N2O5/c1-9(18(27)23-12-7-6-11(20)15(21)16(12)22)29-14(25)8-24-13-5-3-2-4-10(13)17(26)19(24)28/h2-7,9H,8H2,1H3,(H,23,27)/t9-/m0/s1 |
| InChIKey | QCVQLYUCXLEQLC-VIFPVBQESA-N |
| XLogP | 2.20 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|