C21H20N2O7 — CID 8576627
[(2S)-1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 8576627) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is [(2S)-1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [(2S)-1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 8576627 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [(2S)-1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | COc1ccc(NC(=O)[C@H](C)OC(=O)CN2C(=O)C(=O)c3ccccc32)cc1OC |
| InChI | InChI=1S/C21H20N2O7/c1-12(20(26)22-13-8-9-16(28-2)17(10-13)29-3)30-18(24)11-23-15-7-5-4-6-14(15)19(25)21(23)27/h4-10,12H,11H2,1-3H3,(H,22,26)/t12-/m0/s1 |
| InChIKey | IHQWUYXXZQMKNY-LBPRGKRZSA-N |
| XLogP | 1.80 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|