C17H16N2O4 — CID 134086768
1-[(3,4-dimethoxyanilino)methyl]indole-2,3-dione (PubChem CID 134086768) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyanilino)methyl]indole-2,3-dione.
| Compound Name | 1-[(3,4-dimethoxyanilino)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 134086768 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[(3,4-dimethoxyanilino)methyl]indole-2,3-dione |
| SMILES | COc1ccc(NCN2C(=O)C(=O)c3ccccc32)cc1OC |
| InChI | InChI=1S/C17H16N2O4/c1-22-14-8-7-11(9-15(14)23-2)18-10-19-13-6-4-3-5-12(13)16(20)17(19)21/h3-9,18H,10H2,1-2H3 |
| InChIKey | VHUZRQPGLFCEOW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|