C16H14N2O3 — CID 21204155
1-[(4-methoxyanilino)methyl]indole-2,3-dione (PubChem CID 21204155) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-[(4-methoxyanilino)methyl]indole-2,3-dione.
| Compound Name | 1-[(4-methoxyanilino)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 21204155 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-[(4-methoxyanilino)methyl]indole-2,3-dione |
| SMILES | COc1ccc(NCN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C16H14N2O3/c1-21-12-8-6-11(7-9-12)17-10-18-14-5-3-2-4-13(14)15(19)16(18)20/h2-9,17H,10H2,1H3 |
| InChIKey | QNKGAOZGWXYPRS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|