C39H33N3O6 — CID 139203556
1-[[3,5-bis[(2,3-dioxoindol-1-yl)methyl]-2,4,6-triethylphenyl]methyl]indole-2,3-dione (PubChem CID 139203556) has the molecular formula C39H33N3O6 and a molecular weight of 639.71 g/mol. Its IUPAC name is 1-[[3,5-bis[(2,3-dioxoindol-1-yl)methyl]-2,4,6-triethylphenyl]methyl]indole-2,3-dione.
| Compound Name | 1-[[3,5-bis[(2,3-dioxoindol-1-yl)methyl]-2,4,6-triethylphenyl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 139203556 |
| Molecular Formula | C39H33N3O6 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | 1-[[3,5-bis[(2,3-dioxoindol-1-yl)methyl]-2,4,6-triethylphenyl]methyl]indole-2,3-dione |
| SMILES | CCc1c(CN2C(=O)C(=O)c3ccccc32)c(CC)c(CN2C(=O)C(=O)c3ccccc32)c(CC)c1CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C39H33N3O6/c1-4-22-28(19-40-31-16-10-7-13-25(31)34(43)37(40)46)23(5-2)30(21-42-33-18-12-9-15-27(33)36(45)39(42)48)24(6-3)29(22)20-41-32-17-11-8-14-26(32)35(44)38(41)47/h7-18H,4-6,19-21H2,1-3H3 |
| InChIKey | RDEYBXNBBADTGC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|