C22H22N4O4+2 — CID 7024887
1-[[4-[(2,3-dioxoindol-1-yl)methyl]piperazine-1,4-diium-1-yl]methyl]indole-2,3-dione (PubChem CID 7024887) has the molecular formula C22H22N4O4+2 and a molecular weight of 406.44 g/mol. Its IUPAC name is 1-[[4-[(2,3-dioxoindol-1-yl)methyl]piperazine-1,4-diium-1-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[4-[(2,3-dioxoindol-1-yl)methyl]piperazine-1,4-diium-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 7024887 |
| Molecular Formula | C22H22N4O4+2 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[[4-[(2,3-dioxoindol-1-yl)methyl]piperazine-1,4-diium-1-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(C[NH+]2CC[NH+](CN3C(=O)C(=O)c4ccccc43)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H20N4O4/c27-19-15-5-1-3-7-17(15)25(21(19)29)13-23-9-11-24(12-10-23)14-26-18-8-4-2-6-16(18)20(28)22(26)30/h1-8H,9-14H2/p+2 |
| InChIKey | QNSIMBIKSYSEFS-UHFFFAOYSA-P |
| XLogP | -1.86 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|