C21H22FN2O2+ — CID 9193463
1-[(4-benzylpiperidin-1-ium-1-yl)methyl]-6-fluoroindole-2,3-dione (PubChem CID 9193463) has the molecular formula C21H22FN2O2+ and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-[(4-benzylpiperidin-1-ium-1-yl)methyl]-6-fluoroindole-2,3-dione.
| Compound Name | 1-[(4-benzylpiperidin-1-ium-1-yl)methyl]-6-fluoroindole-2,3-dione |
|---|---|
| PubChem CID | 9193463 |
| Molecular Formula | C21H22FN2O2+ |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[(4-benzylpiperidin-1-ium-1-yl)methyl]-6-fluoroindole-2,3-dione |
| SMILES | O=C1C(=O)N(C[NH+]2CCC(Cc3ccccc3)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C21H21FN2O2/c22-17-6-7-18-19(13-17)24(21(26)20(18)25)14-23-10-8-16(9-11-23)12-15-4-2-1-3-5-15/h1-7,13,16H,8-12,14H2/p+1 |
| InChIKey | QKZSMPQEGKQVNH-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|