C17H19FN3O3+ — CID 9360915
1-[[4-(cyclopropanecarbonyl)piperazin-1-ium-1-yl]methyl]-6-fluoroindole-2,3-dione (PubChem CID 9360915) has the molecular formula C17H19FN3O3+ and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-[[4-(cyclopropanecarbonyl)piperazin-1-ium-1-yl]methyl]-6-fluoroindole-2,3-dione.
| Compound Name | 1-[[4-(cyclopropanecarbonyl)piperazin-1-ium-1-yl]methyl]-6-fluoroindole-2,3-dione |
|---|---|
| PubChem CID | 9360915 |
| Molecular Formula | C17H19FN3O3+ |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[[4-(cyclopropanecarbonyl)piperazin-1-ium-1-yl]methyl]-6-fluoroindole-2,3-dione |
| SMILES | O=C1C(=O)N(C[NH+]2CCN(C(=O)C3CC3)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C17H18FN3O3/c18-12-3-4-13-14(9-12)21(17(24)15(13)22)10-19-5-7-20(8-6-19)16(23)11-1-2-11/h3-4,9,11H,1-2,5-8,10H2/p+1 |
| InChIKey | PMTCRBACOWLXMV-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|