C17H16FN2O2S+ — CID 9279157
6-fluoro-1-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]indole-2,3-dione (PubChem CID 9279157) has the molecular formula C17H16FN2O2S+ and a molecular weight of 331.39 g/mol. Its IUPAC name is 6-fluoro-1-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]indole-2,3-dione.
| Compound Name | 6-fluoro-1-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 9279157 |
| Molecular Formula | C17H16FN2O2S+ |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 6-fluoro-1-[[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(C[NH+]2CCC[C@@H]2c2cccs2)c2cc(F)ccc21 |
| InChI | InChI=1S/C17H15FN2O2S/c18-11-5-6-12-14(9-11)20(17(22)16(12)21)10-19-7-1-3-13(19)15-4-2-8-23-15/h2,4-6,8-9,13H,1,3,7,10H2/p+1/t13-/m1/s1 |
| InChIKey | SCJZGEAZIWRZGT-CYBMUJFWSA-O |
| XLogP | 1.79 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|