C21H19N2O2S2+ — CID 9325216
5-methyl-1-[[(4R)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]indole-2,3-dione (PubChem CID 9325216) has the molecular formula C21H19N2O2S2+ and a molecular weight of 395.53 g/mol. Its IUPAC name is 5-methyl-1-[[(4R)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]indole-2,3-dione.
| Compound Name | 5-methyl-1-[[(4R)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 9325216 |
| Molecular Formula | C21H19N2O2S2+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 5-methyl-1-[[(4R)-4-thiophen-2-yl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]indole-2,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)C(=O)N2C[NH+]1CCc2sccc2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C21H18N2O2S2/c1-13-4-5-16-15(11-13)20(24)21(25)23(16)12-22-8-6-17-14(7-10-27-17)19(22)18-3-2-9-26-18/h2-5,7,9-11,19H,6,8,12H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | SPHDTLAATAMBHR-LJQANCHMSA-O |
| XLogP | 2.84 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|