C13H16N3O3S+ — CID 9321667
1-methyl-3-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 9321667) has the molecular formula C13H16N3O3S+ and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-methyl-3-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-methyl-3-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9321667 |
| Molecular Formula | C13H16N3O3S+ |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-methyl-3-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | C[C@H]1c2ccsc2CC[NH+]1CN1C(=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C13H15N3O3S/c1-8-9-4-6-20-10(9)3-5-15(8)7-16-12(18)11(17)14(2)13(16)19/h4,6,8H,3,5,7H2,1-2H3/p+1/t8-/m0/s1 |
| InChIKey | RQUVYXIFBHPVOY-QMMMGPOBSA-O |
| XLogP | -0.37 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|