C16H22N3O3S2+ — CID 9321678
N,N-dimethyl-1-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-6-oxopyridine-3-sulfonamide (PubChem CID 9321678) has the molecular formula C16H22N3O3S2+ and a molecular weight of 368.50 g/mol. Its IUPAC name is N,N-dimethyl-1-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-6-oxopyridine-3-sulfonamide.
| Compound Name | N,N-dimethyl-1-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-6-oxopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 9321678 |
| Molecular Formula | C16H22N3O3S2+ |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N,N-dimethyl-1-[[(4R)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-6-oxopyridine-3-sulfonamide |
| SMILES | C[C@@H]1c2ccsc2CC[NH+]1Cn1cc(S(=O)(=O)N(C)C)ccc1=O |
| InChI | InChI=1S/C16H21N3O3S2/c1-12-14-7-9-23-15(14)6-8-18(12)11-19-10-13(4-5-16(19)20)24(21,22)17(2)3/h4-5,7,9-10,12H,6,8,11H2,1-3H3/p+1/t12-/m1/s1 |
| InChIKey | BPNMIFJKVNWROU-GFCCVEGCSA-O |
| XLogP | 0.32 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |