C15H18N3O3S+ — CID 9320830
1-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-nitropyridin-2-one (PubChem CID 9320830) has the molecular formula C15H18N3O3S+ and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-nitropyridin-2-one.
| Compound Name | 1-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 9320830 |
| Molecular Formula | C15H18N3O3S+ |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-[[(4S)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-nitropyridin-2-one |
| SMILES | CC[C@H]1c2ccsc2CC[NH+]1Cn1cc([N+](=O)[O-])ccc1=O |
| InChI | InChI=1S/C15H17N3O3S/c1-2-13-12-6-8-22-14(12)5-7-16(13)10-17-9-11(18(20)21)3-4-15(17)19/h3-4,6,8-9,13H,2,5,7,10H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | VQJNRKABJSCNMS-ZDUSSCGKSA-O |
| XLogP | 1.37 |
| TPSA | 69.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|