C9H9N5O3S — CID 80608894
1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-nitropyridin-2-one (PubChem CID 80608894) has the molecular formula C9H9N5O3S and a molecular weight of 267.27 g/mol. Its IUPAC name is 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-nitropyridin-2-one.
| Compound Name | 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 80608894 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-nitropyridin-2-one |
| SMILES | CNc1nnc(Cn2cc([N+](=O)[O-])ccc2=O)s1 |
| InChI | InChI=1S/C9H9N5O3S/c1-10-9-12-11-7(18-9)5-13-4-6(14(16)17)2-3-8(13)15/h2-4H,5H2,1H3,(H,10,12) |
| InChIKey | UPZWKVVDLIXDDJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|