C16H12FN5O4S — CID 33275313
N-[(4-fluorophenyl)methyl]-5-[(5-nitro-2-oxo-1-pyridinyl)methyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 33275313) has the molecular formula C16H12FN5O4S and a molecular weight of 389.37 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-[(5-nitro-2-oxo-1-pyridinyl)methyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-[(5-nitro-2-oxo-1-pyridinyl)methyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 33275313 |
| Molecular Formula | C16H12FN5O4S |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-[(5-nitro-2-oxo-1-pyridinyl)methyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1nnc(Cn2cc([N+](=O)[O-])ccc2=O)s1 |
| InChI | InChI=1S/C16H12FN5O4S/c17-11-3-1-10(2-4-11)7-18-15(24)16-20-19-13(27-16)9-21-8-12(22(25)26)5-6-14(21)23/h1-6,8H,7,9H2,(H,18,24) |
| InChIKey | IYWVTQGARYXBFL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|