C17H20NO3S+ — CID 9320418
6-[[(4R)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-benzodioxol-5-ol (PubChem CID 9320418) has the molecular formula C17H20NO3S+ and a molecular weight of 318.42 g/mol. Its IUPAC name is 6-[[(4R)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[[(4R)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 9320418 |
| Molecular Formula | C17H20NO3S+ |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 6-[[(4R)-4-ethyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-1,3-benzodioxol-5-ol |
| SMILES | CC[C@@H]1c2ccsc2CC[NH+]1Cc1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C17H19NO3S/c1-2-13-12-4-6-22-17(12)3-5-18(13)9-11-7-15-16(8-14(11)19)21-10-20-15/h4,6-8,13,19H,2-3,5,9-10H2,1H3/p+1/t13-/m1/s1 |
| InChIKey | MDVFXMFDOASGIT-CYBMUJFWSA-O |
| XLogP | 2.27 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|