C14H12O3 — CID 14640212
6-benzyl-1,3-benzodioxol-5-ol (PubChem CID 14640212) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 6-benzyl-1,3-benzodioxol-5-ol.
| Compound Name | 6-benzyl-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 14640212 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 6-benzyl-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1Cc1ccccc1)OCO2 |
| InChI | InChI=1S/C14H12O3/c15-12-8-14-13(16-9-17-14)7-11(12)6-10-4-2-1-3-5-10/h1-5,7-8,15H,6,9H2 |
| InChIKey | DADMXFLBMWIAAZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |