C18H17NaO4S — CID 23694544
sodium 2-[2-(6-benzyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetate (PubChem CID 23694544) has the molecular formula C18H17NaO4S and a molecular weight of 352.39 g/mol. Its IUPAC name is sodium 2-[2-(6-benzyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetate.
| Compound Name | sodium 2-[2-(6-benzyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetate |
|---|---|
| PubChem CID | 23694544 |
| Molecular Formula | C18H17NaO4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | sodium 2-[2-(6-benzyl-1,3-benzodioxol-5-yl)ethylsulfanyl]acetate |
| SMILES | O=C([O-])CSCCc1cc2c(cc1Cc1ccccc1)OCO2.[Na+] |
| InChI | InChI=1S/C18H18O4S.Na/c19-18(20)11-23-7-6-14-9-16-17(22-12-21-16)10-15(14)8-13-4-2-1-3-5-13;/h1-5,9-10H,6-8,11-12H2,(H,19,20);/q;+1/p-1 |
| InChIKey | CLZCUTWVGPBZSP-UHFFFAOYSA-M |
| XLogP | -0.96 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|