C22H16O4 — CID 159306695
2-(6-benzoyl-1,3-benzodioxol-5-yl)-1-phenylethanone (PubChem CID 159306695) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-(6-benzoyl-1,3-benzodioxol-5-yl)-1-phenylethanone.
| Compound Name | 2-(6-benzoyl-1,3-benzodioxol-5-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 159306695 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-(6-benzoyl-1,3-benzodioxol-5-yl)-1-phenylethanone |
| SMILES | O=C(Cc1cc2c(cc1C(=O)c1ccccc1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C22H16O4/c23-19(15-7-3-1-4-8-15)11-17-12-20-21(26-14-25-20)13-18(17)22(24)16-9-5-2-6-10-16/h1-10,12-13H,11,14H2 |
| InChIKey | LBZVTGKWMADTLO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |