C23H21N2O4+ — CID 2351373
1,3-benzodioxol-5-ylmethyl-[2-(2-benzoylanilino)-2-oxoethyl]azanium (PubChem CID 2351373) has the molecular formula C23H21N2O4+ and a molecular weight of 389.43 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[2-(2-benzoylanilino)-2-oxoethyl]azanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[2-(2-benzoylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2351373 |
| Molecular Formula | C23H21N2O4+ |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[2-(2-benzoylanilino)-2-oxoethyl]azanium |
| SMILES | O=C(C[NH2+]Cc1ccc2c(c1)OCO2)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O4/c26-22(14-24-13-16-10-11-20-21(12-16)29-15-28-20)25-19-9-5-4-8-18(19)23(27)17-6-2-1-3-7-17/h1-12,24H,13-15H2,(H,25,26)/p+1 |
| InChIKey | MLKIDJFDDVYCQB-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |