C26H18N2O6 — CID 2369683
[2-(2-benzoylanilino)-2-oxoethyl] (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate (PubChem CID 2369683) has the molecular formula C26H18N2O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is [2-(2-benzoylanilino)-2-oxoethyl] (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate.
| Compound Name | [2-(2-benzoylanilino)-2-oxoethyl] (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 2369683 |
| Molecular Formula | C26H18N2O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [2-(2-benzoylanilino)-2-oxoethyl] (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate |
| SMILES | N#C/C(=C/c1ccc2c(c1)OCO2)C(=O)OCC(=O)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H18N2O6/c27-14-19(12-17-10-11-22-23(13-17)34-16-33-22)26(31)32-15-24(29)28-21-9-5-4-8-20(21)25(30)18-6-2-1-3-7-18/h1-13H,15-16H2,(H,28,29)/b19-12- |
| InChIKey | FVNQOUAFTMZPIX-UNOMPAQXSA-N |
| XLogP | 3.74 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|