C19H13BrN2O5 — CID 2356807
[2-(4-bromoanilino)-2-oxoethyl] (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate (PubChem CID 2356807) has the molecular formula C19H13BrN2O5 and a molecular weight of 429.23 g/mol. Its IUPAC name is [2-(4-bromoanilino)-2-oxoethyl] (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate.
| Compound Name | [2-(4-bromoanilino)-2-oxoethyl] (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 2356807 |
| Molecular Formula | C19H13BrN2O5 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | [2-(4-bromoanilino)-2-oxoethyl] (Z)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate |
| SMILES | N#C/C(=C/c1ccc2c(c1)OCO2)C(=O)OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H13BrN2O5/c20-14-2-4-15(5-3-14)22-18(23)10-25-19(24)13(9-21)7-12-1-6-16-17(8-12)27-11-26-16/h1-8H,10-11H2,(H,22,23)/b13-7- |
| InChIKey | KIPXXHJDAWRVMK-QPEQYQDCSA-N |
| XLogP | 3.27 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|