C20H12ClF3N2O5 — CID 2356203
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate (PubChem CID 2356203) has the molecular formula C20H12ClF3N2O5 and a molecular weight of 452.77 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 2356203 |
| Molecular Formula | C20H12ClF3N2O5 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCO2)C(=O)OCC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H12ClF3N2O5/c21-15-3-2-13(7-14(15)20(22,23)24)26-18(27)9-29-19(28)12(8-25)5-11-1-4-16-17(6-11)31-10-30-16/h1-7H,9-10H2,(H,26,27)/b12-5+ |
| InChIKey | WXFSXPILVDDTAX-LFYBBSHMSA-N |
| XLogP | 4.18 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|