C22H24N2O5 — CID 51278293
2-[3-(1,3-benzodioxol-5-yl)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 51278293) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 51278293 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)Nc1ccccc1C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C22H24N2O5/c25-21(10-8-15-7-9-19-20(12-15)29-14-28-19)24-18-6-2-1-5-17(18)22(26)23-13-16-4-3-11-27-16/h1-2,5-7,9,12,16H,3-4,8,10-11,13-14H2,(H,23,26)(H,24,25) |
| InChIKey | AJKCDHUTKXHRBJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |