C9H6O6 — CID 610879
1,3-benzodioxole-5,6-dicarboxylic acid (PubChem CID 610879) has the molecular formula C9H6O6 and a molecular weight of 210.14 g/mol. Its IUPAC name is 1,3-benzodioxole-5,6-dicarboxylic acid.
| Compound Name | 1,3-benzodioxole-5,6-dicarboxylic acid |
|---|---|
| PubChem CID | 610879 |
| Molecular Formula | C9H6O6 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 1,3-benzodioxole-5,6-dicarboxylic acid |
| SMILES | O=C(O)c1cc2c(cc1C(=O)O)OCO2 |
| InChI | InChI=1S/C9H6O6/c10-8(11)4-1-6-7(15-3-14-6)2-5(4)9(12)13/h1-2H,3H2,(H,10,11)(H,12,13) |
| InChIKey | UMEVZMYDJGBHMC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |