C8H6ClNO4 — CID 84681314
7-amino-6-chloro-1,3-benzodioxole-5-carboxylic acid (PubChem CID 84681314) has the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. Its IUPAC name is 7-amino-6-chloro-1,3-benzodioxole-5-carboxylic acid.
| Compound Name | 7-amino-6-chloro-1,3-benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 84681314 |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.59 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | 7-amino-6-chloro-1,3-benzodioxole-5-carboxylic acid |
| SMILES | Nc1c(Cl)c(C(=O)O)cc2c1OCO2 |
| InChI | InChI=1S/C8H6ClNO4/c9-5-3(8(11)12)1-4-7(6(5)10)14-2-13-4/h1H,2,10H2,(H,11,12) |
| InChIKey | MZIUIBYXLNTRLU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.59 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|