C10H7ClO5 — CID 117358406
2-(6-chloro-4-methyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid (PubChem CID 117358406) has the molecular formula C10H7ClO5 and a molecular weight of 242.61 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid.
| Compound Name | 2-(6-chloro-4-methyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117358406 |
| Molecular Formula | C10H7ClO5 |
| Molecular Weight | 242.61 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 2-(6-chloro-4-methyl-1,3-benzodioxol-5-yl)-2-oxoacetic acid |
| SMILES | Cc1c2c(cc(Cl)c1C(=O)C(=O)O)OCO2 |
| InChI | InChI=1S/C10H7ClO5/c1-4-7(8(12)10(13)14)5(11)2-6-9(4)16-3-15-6/h2H,3H2,1H3,(H,13,14) |
| InChIKey | CYIHREHXLLPRQJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.61 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|