C12H12O5 — CID 117344307
2-(5,6-dimethyl-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxoacetic acid (PubChem CID 117344307) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is 2-(5,6-dimethyl-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxoacetic acid.
| Compound Name | 2-(5,6-dimethyl-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117344307 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-(5,6-dimethyl-2,3-dihydro-1,4-benzodioxin-7-yl)-2-oxoacetic acid |
| SMILES | Cc1c(C(=O)C(=O)O)cc2c(c1C)OCCO2 |
| InChI | InChI=1S/C12H12O5/c1-6-7(2)11-9(16-3-4-17-11)5-8(6)10(13)12(14)15/h5H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | GCLYWBZIACMBTM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|