C10H8O5 — CID 117297042
2-(7-methyl-1,3-benzodioxol-4-yl)-2-oxoacetic acid (PubChem CID 117297042) has the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-(7-methyl-1,3-benzodioxol-4-yl)-2-oxoacetic acid.
| Compound Name | 2-(7-methyl-1,3-benzodioxol-4-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117297042 |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2-(7-methyl-1,3-benzodioxol-4-yl)-2-oxoacetic acid |
| SMILES | Cc1ccc(C(=O)C(=O)O)c2c1OCO2 |
| InChI | InChI=1S/C10H8O5/c1-5-2-3-6(7(11)10(12)13)9-8(5)14-4-15-9/h2-3H,4H2,1H3,(H,12,13) |
| InChIKey | LAIBLANKJLJLQX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|