C12H11ClO6 — CID 117462242
ethyl 2-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)-2-oxoacetate (PubChem CID 117462242) has the molecular formula C12H11ClO6 and a molecular weight of 286.67 g/mol. Its IUPAC name is ethyl 2-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 117462242 |
| Molecular Formula | C12H11ClO6 |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | ethyl 2-(7-chloro-6-methoxy-1,3-benzodioxol-5-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc2c(c(Cl)c1OC)OCO2 |
| InChI | InChI=1S/C12H11ClO6/c1-3-17-12(15)9(14)6-4-7-11(19-5-18-7)8(13)10(6)16-2/h4H,3,5H2,1-2H3 |
| InChIKey | OSQQIPHIGYTGFK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|